C11H15N3O2 — CID 62507452
1-N-(cyclobutylmethyl)-4-nitrobenzene-1,2-diamine (PubChem CID 62507452) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-N-(cyclobutylmethyl)-4-nitrobenzene-1,2-diamine.
| Compound Name | 1-N-(cyclobutylmethyl)-4-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 62507452 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-N-(cyclobutylmethyl)-4-nitrobenzene-1,2-diamine |
| SMILES | Nc1cc([N+](=O)[O-])ccc1NCC1CCC1 |
| InChI | InChI=1S/C11H15N3O2/c12-10-6-9(14(15)16)4-5-11(10)13-7-8-2-1-3-8/h4-6,8,13H,1-3,7,12H2 |
| InChIKey | VADVOHRROMNUDL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|