C13H17IN2O3 — CID 106130004
4-[(2-iodo-4-nitroanilino)methyl]cyclohexan-1-ol (PubChem CID 106130004) has the molecular formula C13H17IN2O3 and a molecular weight of 376.19 g/mol. Its IUPAC name is 4-[(2-iodo-4-nitroanilino)methyl]cyclohexan-1-ol.
| Compound Name | 4-[(2-iodo-4-nitroanilino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106130004 |
| Molecular Formula | C13H17IN2O3 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-[(2-iodo-4-nitroanilino)methyl]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(NCC2CCC(O)CC2)c(I)c1 |
| InChI | InChI=1S/C13H17IN2O3/c14-12-7-10(16(18)19)3-6-13(12)15-8-9-1-4-11(17)5-2-9/h3,6-7,9,11,15,17H,1-2,4-5,8H2 |
| InChIKey | GQYHDYCWPVRFQA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|