C15H13IN2O2 — CID 66095323
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-iodo-4-nitroaniline (PubChem CID 66095323) has the molecular formula C15H13IN2O2 and a molecular weight of 380.19 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-iodo-4-nitroaniline.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-iodo-4-nitroaniline |
|---|---|
| PubChem CID | 66095323 |
| Molecular Formula | C15H13IN2O2 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-iodo-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NCC2Cc3ccccc32)c(I)c1 |
| InChI | InChI=1S/C15H13IN2O2/c16-14-8-12(18(19)20)5-6-15(14)17-9-11-7-10-3-1-2-4-13(10)11/h1-6,8,11,17H,7,9H2 |
| InChIKey | TXWQOLLXFQSHMQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|