C16H27NO3Si — CID 58994475
tert-butyl-dimethyl-[2-methyl-2-(4-nitrophenyl)propoxy]silane (PubChem CID 58994475) has the molecular formula C16H27NO3Si and a molecular weight of 309.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-methyl-2-(4-nitrophenyl)propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-methyl-2-(4-nitrophenyl)propoxy]silane |
|---|---|
| PubChem CID | 58994475 |
| Molecular Formula | C16H27NO3Si |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | tert-butyl-dimethyl-[2-methyl-2-(4-nitrophenyl)propoxy]silane |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H27NO3Si/c1-15(2,3)21(6,7)20-12-16(4,5)13-8-10-14(11-9-13)17(18)19/h8-11H,12H2,1-7H3 |
| InChIKey | BSWYBLXXAQNQFU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|