C14H22F2N2O4Si — CID 146968088
tert-butyl-[2,2-difluoro-3-[(5-nitro-2-pyridinyl)oxy]propoxy]-dimethylsilane (PubChem CID 146968088) has the molecular formula C14H22F2N2O4Si and a molecular weight of 348.42 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-3-[(5-nitro-2-pyridinyl)oxy]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2,2-difluoro-3-[(5-nitro-2-pyridinyl)oxy]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 146968088 |
| Molecular Formula | C14H22F2N2O4Si |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl-[2,2-difluoro-3-[(5-nitro-2-pyridinyl)oxy]propoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)COc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H22F2N2O4Si/c1-13(2,3)23(4,5)22-10-14(15,16)9-21-12-7-6-11(8-17-12)18(19)20/h6-8H,9-10H2,1-5H3 |
| InChIKey | ALWZMDKYUDOAQN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|