C13H21ClF2N4O3Si — CID 152535511
N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl]-6-chloro-5-nitropyrimidin-4-amine (PubChem CID 152535511) has the molecular formula C13H21ClF2N4O3Si and a molecular weight of 382.87 g/mol. Its IUPAC name is N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl]-6-chloro-5-nitropyrimidin-4-amine.
| Compound Name | N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl]-6-chloro-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 152535511 |
| Molecular Formula | C13H21ClF2N4O3Si |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl]-6-chloro-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)CNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21ClF2N4O3Si/c1-12(2,3)24(4,5)23-7-13(15,16)6-17-11-9(20(21)22)10(14)18-8-19-11/h8H,6-7H2,1-5H3,(H,17,18,19) |
| InChIKey | YKLDAAATVBTMCW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|