C8H11ClN4O4 — CID 62505223
2-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]ethoxy]ethanol (PubChem CID 62505223) has the molecular formula C8H11ClN4O4 and a molecular weight of 262.65 g/mol. Its IUPAC name is 2-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 62505223 |
| Molecular Formula | C8H11ClN4O4 |
| Molecular Weight | 262.65 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]ethoxy]ethanol |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1NCCOCCO |
| InChI | InChI=1S/C8H11ClN4O4/c9-7-6(13(15)16)8(12-5-11-7)10-1-3-17-4-2-14/h5,14H,1-4H2,(H,10,11,12) |
| InChIKey | VMAYCVGQXYYGCE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.65 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|