C34H42N4O8Si — CID 160637789
tert-butyl-dimethyl-[3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propoxy]silane;3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-1-ol (PubChem CID 160637789) has the molecular formula C34H42N4O8Si and a molecular weight of 662.82 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propoxy]silane;3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-1-ol.
| Compound Name | tert-butyl-dimethyl-[3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propoxy]silane;3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 160637789 |
| Molecular Formula | C34H42N4O8Si |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | tert-butyl-dimethyl-[3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propoxy]silane;3-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCc1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1.O=[N+]([O-])c1ccc(Oc2ccc(CCCO)cc2)nc1 |
| InChI | InChI=1S/C20H28N2O4Si.C14H14N2O4/c1-20(2,3)27(4,5)25-14-6-7-16-8-11-18(12-9-16)26-19-13-10-17(15-21-19)22(23)24;17-9-1-2-11-3-6-13(7-4-11)20-14-8-5-12(10-15-14)16(18)19/h8-13,15H,6-7,14H2,1-5H3;3-8,10,17H,1-2,9H2 |
| InChIKey | RITOYZMJNRLVDR-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|