C36H62O5Si2 — CID 68632649
2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]acetic acid;2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]ethanol (PubChem CID 68632649) has the molecular formula C36H62O5Si2 and a molecular weight of 631.06 g/mol. Its IUPAC name is 2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]acetic acid;2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]ethanol.
| Compound Name | 2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]acetic acid;2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]ethanol |
|---|---|
| PubChem CID | 68632649 |
| Molecular Formula | C36H62O5Si2 |
| Molecular Weight | 631.06 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | 2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]acetic acid;2-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCc1ccc(CC(=O)O)cc1.CC(C)(C)[Si](C)(C)OCCCCc1ccc(CCO)cc1 |
| InChI | InChI=1S/C18H30O3Si.C18H32O2Si/c1-18(2,3)22(4,5)21-13-7-6-8-15-9-11-16(12-10-15)14-17(19)20;1-18(2,3)21(4,5)20-15-7-6-8-16-9-11-17(12-10-16)13-14-19/h9-12H,6-8,13-14H2,1-5H3,(H,19,20);9-12,19H,6-8,13-15H2,1-5H3 |
| InChIKey | KPGFGNSVYRRDFB-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.06 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|