C18H26N2O5SSi — CID 173407322
S-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl] 4-nitrobenzenecarbothioate (PubChem CID 173407322) has the molecular formula C18H26N2O5SSi and a molecular weight of 410.57 g/mol. Its IUPAC name is S-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl] 4-nitrobenzenecarbothioate.
| Compound Name | S-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl] 4-nitrobenzenecarbothioate |
|---|---|
| PubChem CID | 173407322 |
| Molecular Formula | C18H26N2O5SSi |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | S-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl] 4-nitrobenzenecarbothioate |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1NC(=O)[C@H]1SC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H26N2O5SSi/c1-18(2,3)27(4,5)25-11-10-14-15(16(21)19-14)26-17(22)12-6-8-13(9-7-12)20(23)24/h6-9,14-15H,10-11H2,1-5H3,(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | MZPRTHSFTPXLOG-CABCVRRESA-N |
| XLogP | 3.75 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|