C23H34N2O6SSi — CID 70432506
(4-nitrophenyl)methyl 2-[(3S,4R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylsulfanylazetidin-1-yl]acetate (PubChem CID 70432506) has the molecular formula C23H34N2O6SSi and a molecular weight of 494.69 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(3S,4R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylsulfanylazetidin-1-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(3S,4R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylsulfanylazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 70432506 |
| Molecular Formula | C23H34N2O6SSi |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(3S,4R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-prop-2-enylsulfanylazetidin-1-yl]acetate |
| SMILES | C=CCS[C@@H]1[C@@H](CCO[Si](C)(C)C(C)(C)C)C(=O)N1CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H34N2O6SSi/c1-7-14-32-22-19(12-13-31-33(5,6)23(2,3)4)21(27)24(22)15-20(26)30-16-17-8-10-18(11-9-17)25(28)29/h7-11,19,22H,1,12-16H2,2-6H3/t19-,22+/m0/s1 |
| InChIKey | MZDUVLRZXORSPW-SIKLNZKXSA-N |
| XLogP | 4.75 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|