C22H30N2O7SSi — CID 18607660
(4-nitrophenyl)methyl (5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-formyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 18607660) has the molecular formula C22H30N2O7SSi and a molecular weight of 494.64 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-formyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-formyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 18607660 |
| Molecular Formula | C22H30N2O7SSi |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-formyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)C(C=O)S[C@H]12 |
| InChI | InChI=1S/C22H30N2O7SSi/c1-22(2,3)33(4,5)31-11-10-16-19(26)23-18(17(12-25)32-20(16)23)21(27)30-13-14-6-8-15(9-7-14)24(28)29/h6-9,12,16-18,20H,10-11,13H2,1-5H3/t16-,17?,18?,20+/m0/s1 |
| InChIKey | YSKNTFACHPOAHK-USWSCHJFSA-N |
| XLogP | 3.52 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|