C28H46N2O7Si2 — CID 70535346
[(2E)-2-[1-[tert-butyl(dimethyl)silyl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-ylidene]propyl] (4-nitrophenyl)methyl carbonate (PubChem CID 70535346) has the molecular formula C28H46N2O7Si2 and a molecular weight of 578.86 g/mol. Its IUPAC name is [(2E)-2-[1-[tert-butyl(dimethyl)silyl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-ylidene]propyl] (4-nitrophenyl)methyl carbonate.
| Compound Name | [(2E)-2-[1-[tert-butyl(dimethyl)silyl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-ylidene]propyl] (4-nitrophenyl)methyl carbonate |
|---|---|
| PubChem CID | 70535346 |
| Molecular Formula | C28H46N2O7Si2 |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | [(2E)-2-[1-[tert-butyl(dimethyl)silyl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-ylidene]propyl] (4-nitrophenyl)methyl carbonate |
| SMILES | C/C(COC(=O)OCc1ccc([N+](=O)[O-])cc1)=C1\C(=O)N([Si](C)(C)C(C)(C)C)C1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H46N2O7Si2/c1-20(18-35-26(32)36-19-21-12-14-22(15-13-21)30(33)34)24-23(16-17-37-39(10,11)28(5,6)7)29(25(24)31)38(8,9)27(2,3)4/h12-15,23H,16-19H2,1-11H3/b24-20+ |
| InChIKey | HLVRZIJMZSKKAC-HIXSDJFHSA-N |
| XLogP | 7.19 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|