C25H42N2O7Si2 — CID 132528209
(4-nitrophenyl)methyl 2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-3,6-dihydrooxazine-4-carboxylate (PubChem CID 132528209) has the molecular formula C25H42N2O7Si2 and a molecular weight of 538.79 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-3,6-dihydrooxazine-4-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-3,6-dihydrooxazine-4-carboxylate |
|---|---|
| PubChem CID | 132528209 |
| Molecular Formula | C25H42N2O7Si2 |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | (4-nitrophenyl)methyl 2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-3,6-dihydrooxazine-4-carboxylate |
| SMILES | CC1C(C(=O)OCc2ccc([N+](=O)[O-])cc2)=C(O[Si](C)(C)C(C)(C)C)CON1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42N2O7Si2/c1-18-22(23(28)31-16-19-12-14-20(15-13-19)26(29)30)21(33-35(8,9)24(2,3)4)17-32-27(18)34-36(10,11)25(5,6)7/h12-15,18H,16-17H2,1-11H3 |
| InChIKey | OFQNJIQZUGADKU-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|