C23H34N2O6Si — CID 10790235
(4-nitrophenyl)methyl (2S,3R,6R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8-oxo-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 10790235) has the molecular formula C23H34N2O6Si and a molecular weight of 462.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3R,6R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8-oxo-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3R,6R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8-oxo-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 10790235 |
| Molecular Formula | C23H34N2O6Si |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3R,6R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8-oxo-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CC[C@H]1C(=O)N2[C@@H]1CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H34N2O6Si/c1-7-17-18-12-13-19(31-32(5,6)23(2,3)4)20(24(18)21(17)26)22(27)30-14-15-8-10-16(11-9-15)25(28)29/h8-11,17-20H,7,12-14H2,1-6H3/t17-,18-,19-,20+/m1/s1 |
| InChIKey | MNMUQOSHQRCSPX-WTGUMLROSA-N |
| XLogP | 4.43 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|