C28H32N2O8SSi — CID 70436413
3-[(5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl]benzoic acid (PubChem CID 70436413) has the molecular formula C28H32N2O8SSi and a molecular weight of 584.72 g/mol. Its IUPAC name is 3-[(5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl]benzoic acid.
| Compound Name | 3-[(5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl]benzoic acid |
|---|---|
| PubChem CID | 70436413 |
| Molecular Formula | C28H32N2O8SSi |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 3-[(5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl]benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(c3cccc(C(=O)O)c3)S[C@H]12 |
| InChI | InChI=1S/C28H32N2O8SSi/c1-28(2,3)40(4,5)38-14-13-21-24(31)29-22(27(34)37-16-17-9-11-20(12-10-17)30(35)36)23(39-25(21)29)18-7-6-8-19(15-18)26(32)33/h6-12,15,21,25H,13-14,16H2,1-5H3,(H,32,33)/t21-,25+/m0/s1 |
| InChIKey | FZHPZABWHMZFKH-SQJMNOBHSA-N |
| XLogP | 5.65 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|