C31H38N2O7Si — CID 66652651
(4-nitrophenyl)methyl (4S,5R,6S)-3-(4-acetylphenyl)-4-methyl-7-oxo-6-(2-triethylsilyloxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 66652651) has the molecular formula C31H38N2O7Si and a molecular weight of 578.74 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4S,5R,6S)-3-(4-acetylphenyl)-4-methyl-7-oxo-6-(2-triethylsilyloxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4S,5R,6S)-3-(4-acetylphenyl)-4-methyl-7-oxo-6-(2-triethylsilyloxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 66652651 |
| Molecular Formula | C31H38N2O7Si |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | (4-nitrophenyl)methyl (4S,5R,6S)-3-(4-acetylphenyl)-4-methyl-7-oxo-6-(2-triethylsilyloxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC[Si](CC)(CC)OCC[C@@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(c3ccc(C(C)=O)cc3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C31H38N2O7Si/c1-6-41(7-2,8-3)40-18-17-26-28-20(4)27(24-13-11-23(12-14-24)21(5)34)29(32(28)30(26)35)31(36)39-19-22-9-15-25(16-10-22)33(37)38/h9-16,20,26,28H,6-8,17-19H2,1-5H3/t20-,26-,28+/m0/s1 |
| InChIKey | LVFIMTVJMIMKPV-IYKJZBSOSA-N |
| XLogP | 6.14 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|