C17H16N2O9S — CID 18596554
(5R,6S)-3-(hydroxymethyl)-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 18596554) has the molecular formula C17H16N2O9S and a molecular weight of 424.39 g/mol. Its IUPAC name is (5R,6S)-3-(hydroxymethyl)-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-3-(hydroxymethyl)-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 18596554 |
| Molecular Formula | C17H16N2O9S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | (5R,6S)-3-(hydroxymethyl)-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | O=C(OCC[C@H]1C(=O)N2C(C(=O)O)=C(CO)S[C@H]12)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N2O9S/c20-7-12-13(16(22)23)18-14(21)11(15(18)29-12)5-6-27-17(24)28-8-9-1-3-10(4-2-9)19(25)26/h1-4,11,15,20H,5-8H2,(H,22,23)/t11-,15+/m0/s1 |
| InChIKey | BWSZMDHEIGAGAQ-XHDPSFHLSA-N |
| XLogP | 1.46 |
| TPSA | 156.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|