C28H26N4O11S — CID 173429165
(4-nitrophenyl)methyl 3-[3-(methylamino)-3-oxoprop-1-enyl]sulfanyl-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 173429165) has the molecular formula C28H26N4O11S and a molecular weight of 626.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[3-(methylamino)-3-oxoprop-1-enyl]sulfanyl-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-[3-(methylamino)-3-oxoprop-1-enyl]sulfanyl-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 173429165 |
| Molecular Formula | C28H26N4O11S |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[3-(methylamino)-3-oxoprop-1-enyl]sulfanyl-6-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CNC(=O)C=CSC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(CCOC(=O)OCc3ccc([N+](=O)[O-])cc3)C2C1 |
| InChI | InChI=1S/C28H26N4O11S/c1-29-24(33)11-13-44-23-14-22-21(10-12-41-28(36)43-16-18-4-8-20(9-5-18)32(39)40)26(34)30(22)25(23)27(35)42-15-17-2-6-19(7-3-17)31(37)38/h2-9,11,13,21-22H,10,12,14-16H2,1H3,(H,29,33) |
| InChIKey | UDDTXDFMOPCEEK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 197.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|