C17H26N2O4Si — CID 11268145
(5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-nitrophenyl)pyrrolidin-2-one (PubChem CID 11268145) has the molecular formula C17H26N2O4Si and a molecular weight of 350.49 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-nitrophenyl)pyrrolidin-2-one.
| Compound Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11268145 |
| Molecular Formula | C17H26N2O4Si |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-nitrophenyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H26N2O4Si/c1-17(2,3)24(4,5)23-12-15-10-11-16(20)18(15)13-6-8-14(9-7-13)19(21)22/h6-9,15H,10-12H2,1-5H3/t15-/m0/s1 |
| InChIKey | LXSUPEHCNPDYSA-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|