C16H34O2SSi2 — CID 139700383
tert-butyl-dimethyl-[2-(5-trimethylsilyloxy-3,4-dihydro-2H-thiopyran-4-yl)ethoxy]silane (PubChem CID 139700383) has the molecular formula C16H34O2SSi2 and a molecular weight of 346.69 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-(5-trimethylsilyloxy-3,4-dihydro-2H-thiopyran-4-yl)ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-(5-trimethylsilyloxy-3,4-dihydro-2H-thiopyran-4-yl)ethoxy]silane |
|---|---|
| PubChem CID | 139700383 |
| Molecular Formula | C16H34O2SSi2 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | tert-butyl-dimethyl-[2-(5-trimethylsilyloxy-3,4-dihydro-2H-thiopyran-4-yl)ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1CCSC=C1O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O2SSi2/c1-16(2,3)21(7,8)17-11-9-14-10-12-19-13-15(14)18-20(4,5)6/h13-14H,9-12H2,1-8H3 |
| InChIKey | RVASGNKLISCIBE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|