C12H27NOSi — CID 99771220
tert-butyl-[2-[(2S,3R)-3-ethylaziridin-2-yl]ethoxy]-dimethylsilane (PubChem CID 99771220) has the molecular formula C12H27NOSi and a molecular weight of 229.44 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,3R)-3-ethylaziridin-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2S,3R)-3-ethylaziridin-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 99771220 |
| Molecular Formula | C12H27NOSi |
| Molecular Weight | 229.44 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | tert-butyl-[2-[(2S,3R)-3-ethylaziridin-2-yl]ethoxy]-dimethylsilane |
| SMILES | CC[C@H]1N[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H27NOSi/c1-7-10-11(13-10)8-9-14-15(5,6)12(2,3)4/h10-11,13H,7-9H2,1-6H3/t10-,11+/m1/s1 |
| InChIKey | YELJXPORFJRBJY-MNOVXSKESA-N |
| XLogP | 3.15 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|