About tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane
tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane (PubChem CID 11000178) has the molecular formula C15H33NOSi
and a molecular weight of 271.52 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane |
| PubChem CID | 11000178 |
| Molecular Formula | C15H33NOSi |
| Molecular Weight | 271.52 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane |
| SMILES | CCCCCC[C@H]1N[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H33NOSi/c1-7-8-9-10-11-13-14(16-13)12-17-18(5,6)15(2,3)4/h13-14,16H,7-12H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | NJEXUMJHTNRZTI-ZIAGYGMSSA-N |
| XLogP | 4.32 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane (CID 11000178) is tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane is CCCCCC[C@H]1N[C@@H]1CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane?
The InChIKey is NJEXUMJHTNRZTI-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H33NOSi/c1-7-8-9-10-11-13-14(16-13)12-17-18(5,6)15(2,3)4/h13-14,16H,7-12H2,1-6H3/t13-,14-/m1/s1.
What are the key properties of tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane?
tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane has a molecular weight of 271.52 g/mol, XLogP of 4.32, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[(2S,3R)-3-hexylaziridin-2-yl]methoxy]-dimethylsilane is sourced from PubChem (CID 11000178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).