C30H63NO2Si2 — CID 10506289
tert-butyl-[[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-dodec-2-enyl]piperidin-2-yl]methoxy]-dimethylsilane (PubChem CID 10506289) has the molecular formula C30H63NO2Si2 and a molecular weight of 526.01 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-dodec-2-enyl]piperidin-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-dodec-2-enyl]piperidin-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10506289 |
| Molecular Formula | C30H63NO2Si2 |
| Molecular Weight | 526.01 g/mol |
| Exact Mass | 525.44 |
| IUPAC Name | tert-butyl-[[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-dodec-2-enyl]piperidin-2-yl]methoxy]-dimethylsilane |
| SMILES | CCCCCCCCC/C=C/C[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N1 |
| InChI | InChI=1S/C30H63NO2Si2/c1-12-13-14-15-16-17-18-19-20-21-22-26-23-24-28(33-35(10,11)30(5,6)7)27(31-26)25-32-34(8,9)29(2,3)4/h20-21,26-28,31H,12-19,22-25H2,1-11H3/b21-20+/t26-,27+,28-/m0/s1 |
| InChIKey | FGZIIIROBYMOLU-JARCZVMWSA-N |
| XLogP | 9.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.01 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|