C32H49NO2Si — CID 11755975
tert-butyl-[[(4S,5S)-5-[(E)-dec-1-enyl]-2,2-diphenyl-1,3-oxazolidin-4-yl]methoxy]-dimethylsilane (PubChem CID 11755975) has the molecular formula C32H49NO2Si and a molecular weight of 507.84 g/mol. Its IUPAC name is tert-butyl-[[(4S,5S)-5-[(E)-dec-1-enyl]-2,2-diphenyl-1,3-oxazolidin-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,5S)-5-[(E)-dec-1-enyl]-2,2-diphenyl-1,3-oxazolidin-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11755975 |
| Molecular Formula | C32H49NO2Si |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | tert-butyl-[[(4S,5S)-5-[(E)-dec-1-enyl]-2,2-diphenyl-1,3-oxazolidin-4-yl]methoxy]-dimethylsilane |
| SMILES | CCCCCCCC/C=C/[C@@H]1OC(c2ccccc2)(c2ccccc2)N[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H49NO2Si/c1-7-8-9-10-11-12-13-20-25-30-29(26-34-36(5,6)31(2,3)4)33-32(35-30,27-21-16-14-17-22-27)28-23-18-15-19-24-28/h14-25,29-30,33H,7-13,26H2,1-6H3/b25-20+/t29-,30-/m0/s1 |
| InChIKey | QNVUVACVRNUTST-NZDRZGQZSA-N |
| XLogP | 8.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|