C17H36O3Si — CID 101195176
tert-butyl-[[(4S,6S)-6-butyl-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane (PubChem CID 101195176) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is tert-butyl-[[(4S,6S)-6-butyl-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,6S)-6-butyl-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101195176 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | tert-butyl-[[(4S,6S)-6-butyl-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane |
| SMILES | CCCC[C@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C17H36O3Si/c1-9-10-11-14-12-15(20-17(5,6)19-14)13-18-21(7,8)16(2,3)4/h14-15H,9-13H2,1-8H3/t14-,15-/m0/s1 |
| InChIKey | ZOQLLBNGDICKEX-GJZGRUSLSA-N |
| XLogP | 5.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|