C13H27NO2 — CID 58646740
[(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]methanamine (PubChem CID 58646740) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is [(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]methanamine.
| Compound Name | [(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]methanamine |
|---|---|
| PubChem CID | 58646740 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | [(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]methanamine |
| SMILES | CCCCCC[C@H]1C[C@@H](CN)OC(C)(C)O1 |
| InChI | InChI=1S/C13H27NO2/c1-4-5-6-7-8-11-9-12(10-14)16-13(2,3)15-11/h11-12H,4-10,14H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | OOUPSLABWBFRMA-RYUDHWBXSA-N |
| XLogP | 2.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|