C12H23IO — CID 11255336
(2S,4R)-4-heptyl-2-(iodomethyl)-2-methyloxetane (PubChem CID 11255336) has the molecular formula C12H23IO and a molecular weight of 310.22 g/mol. Its IUPAC name is (2S,4R)-4-heptyl-2-(iodomethyl)-2-methyloxetane.
| Compound Name | (2S,4R)-4-heptyl-2-(iodomethyl)-2-methyloxetane |
|---|---|
| PubChem CID | 11255336 |
| Molecular Formula | C12H23IO |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (2S,4R)-4-heptyl-2-(iodomethyl)-2-methyloxetane |
| SMILES | CCCCCCC[C@@H]1C[C@@](C)(CI)O1 |
| InChI | InChI=1S/C12H23IO/c1-3-4-5-6-7-8-11-9-12(2,10-13)14-11/h11H,3-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | ZGGWFNODXRTVKY-NEPJUHHUSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|