C14H28O — CID 102172667
(2R,6S)-2-ethyl-6-hexyl-2-methyloxane (PubChem CID 102172667) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is (2R,6S)-2-ethyl-6-hexyl-2-methyloxane.
| Compound Name | (2R,6S)-2-ethyl-6-hexyl-2-methyloxane |
|---|---|
| PubChem CID | 102172667 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (2R,6S)-2-ethyl-6-hexyl-2-methyloxane |
| SMILES | CCCCCC[C@H]1CCC[C@@](C)(CC)O1 |
| InChI | InChI=1S/C14H28O/c1-4-6-7-8-10-13-11-9-12-14(3,5-2)15-13/h13H,4-12H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | NHLGTSIIQFTCIA-UONOGXRCSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|