C20H32O3 — CID 102182627
(2R,6R,8S)-8-hexyl-2-(5-methylfuran-2-yl)-1,7-dioxaspiro[5.5]undecane (PubChem CID 102182627) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2R,6R,8S)-8-hexyl-2-(5-methylfuran-2-yl)-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2R,6R,8S)-8-hexyl-2-(5-methylfuran-2-yl)-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102182627 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2R,6R,8S)-8-hexyl-2-(5-methylfuran-2-yl)-1,7-dioxaspiro[5.5]undecane |
| SMILES | CCCCCC[C@H]1CCC[C@@]2(CCC[C@H](c3ccc(C)o3)O2)O1 |
| InChI | InChI=1S/C20H32O3/c1-3-4-5-6-9-17-10-7-14-20(22-17)15-8-11-19(23-20)18-13-12-16(2)21-18/h12-13,17,19H,3-11,14-15H2,1-2H3/t17-,19+,20+/m0/s1 |
| InChIKey | GKBIMNIKBDHZGE-DFQSSKMNSA-N |
| XLogP | 6.07 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|