C15H26O2 — CID 71504682
(2S,6S,8R)-8-butyl-2-ethenyl-1,7-dioxaspiro[5.5]undecane (PubChem CID 71504682) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2S,6S,8R)-8-butyl-2-ethenyl-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2S,6S,8R)-8-butyl-2-ethenyl-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 71504682 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2S,6S,8R)-8-butyl-2-ethenyl-1,7-dioxaspiro[5.5]undecane |
| SMILES | C=C[C@@H]1CCC[C@]2(CCC[C@@H](CCCC)O2)O1 |
| InChI | InChI=1S/C15H26O2/c1-3-5-8-14-10-7-12-15(17-14)11-6-9-13(4-2)16-15/h4,13-14H,2-3,5-12H2,1H3/t13-,14-,15+/m1/s1 |
| InChIKey | ZQPZYSWBEKKQEN-KFWWJZLASA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|