C14H24O — CID 101411288
(2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane (PubChem CID 101411288) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane.
| Compound Name | (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane |
|---|---|
| PubChem CID | 101411288 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane |
| SMILES | C=C=C[C@]1(C)CCC[C@@H](CCCCC)O1 |
| InChI | InChI=1S/C14H24O/c1-4-6-7-9-13-10-8-12-14(3,15-13)11-5-2/h11,13H,2,4,6-10,12H2,1,3H3/t13-,14-/m1/s1 |
| InChIKey | JQZLKQRUOOTEJW-ZIAGYGMSSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|