About (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane
(2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane (PubChem CID 101411288) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane.
Molecular Properties
| Compound Name | (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane |
| PubChem CID | 101411288 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane |
| SMILES | C=C=C[C@]1(C)CCC[C@@H](CCCCC)O1 |
| InChI | InChI=1S/C14H24O/c1-4-6-7-9-13-10-8-12-14(3,15-13)11-5-2/h11,13H,2,4,6-10,12H2,1,3H3/t13-,14-/m1/s1 |
| InChIKey | JQZLKQRUOOTEJW-ZIAGYGMSSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane?
The IUPAC name of (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane (CID 101411288) is (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane.
What is the SMILES notation for (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane?
The canonical SMILES for (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane is C=C=C[C@]1(C)CCC[C@@H](CCCCC)O1.
What is the InChIKey of (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane?
The InChIKey is JQZLKQRUOOTEJW-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H24O/c1-4-6-7-9-13-10-8-12-14(3,15-13)11-5-2/h11,13H,2,4,6-10,12H2,1,3H3/t13-,14-/m1/s1.
What are the key properties of (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane?
(2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane has a molecular weight of 208.34 g/mol, XLogP of 4.24, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2-methyl-6-pentyl-2-propa-1,2-dienyloxane is sourced from PubChem (CID 101411288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).