C22H38O5 — CID 101411299
(1R,3S,4S,6R,8R,10S,12R)-6-[2-(hydroxymethyl)prop-2-enyl]-1-methyl-12-pentyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-4-ol (PubChem CID 101411299) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is (1R,3S,4S,6R,8R,10S,12R)-6-[2-(hydroxymethyl)prop-2-enyl]-1-methyl-12-pentyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-4-ol.
| Compound Name | (1R,3S,4S,6R,8R,10S,12R)-6-[2-(hydroxymethyl)prop-2-enyl]-1-methyl-12-pentyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-4-ol |
|---|---|
| PubChem CID | 101411299 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (1R,3S,4S,6R,8R,10S,12R)-6-[2-(hydroxymethyl)prop-2-enyl]-1-methyl-12-pentyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-4-ol |
| SMILES | C=C(CO)C[C@@H]1C[C@H](O)[C@@H]2O[C@]3(C)CCC[C@@H](CCCCC)O[C@H]3C[C@H]2O1 |
| InChI | InChI=1S/C22H38O5/c1-4-5-6-8-16-9-7-10-22(3)20(26-16)13-19-21(27-22)18(24)12-17(25-19)11-15(2)14-23/h16-21,23-24H,2,4-14H2,1,3H3/t16-,17-,18+,19-,20+,21+,22-/m1/s1 |
| InChIKey | JIIWVKPHRKROFR-YSNDBMGOSA-N |
| XLogP | 3.51 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|