C14H28O3 — CID 134858700
3-[(4R,6S)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 134858700) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 3-[(4R,6S)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | 3-[(4R,6S)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 134858700 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3-[(4R,6S)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | CCCCC[C@H]1C[C@@H](CCCO)OC(C)(C)O1 |
| InChI | InChI=1S/C14H28O3/c1-4-5-6-8-12-11-13(9-7-10-15)17-14(2,3)16-12/h12-13,15H,4-11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | IOVMZTUBBKUZTM-QWHCGFSZSA-N |
| XLogP | 3.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|