C9H18O2 — CID 130757753
(2R,6R)-6-butyloxan-2-ol (PubChem CID 130757753) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (2R,6R)-6-butyloxan-2-ol.
| Compound Name | (2R,6R)-6-butyloxan-2-ol |
|---|---|
| PubChem CID | 130757753 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (2R,6R)-6-butyloxan-2-ol |
| SMILES | CCCC[C@@H]1CCC[C@H](O)O1 |
| InChI | InChI=1S/C9H18O2/c1-2-3-5-8-6-4-7-9(10)11-8/h8-10H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | GAAKIZLDCJAHHD-RKDXNWHRSA-N |
| XLogP | 2.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |