C12H22O2 — CID 10888892
(2S,6R,8S)-2-ethyl-8-methyl-1,7-dioxaspiro[5.5]undecane (PubChem CID 10888892) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2S,6R,8S)-2-ethyl-8-methyl-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2S,6R,8S)-2-ethyl-8-methyl-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10888892 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2S,6R,8S)-2-ethyl-8-methyl-1,7-dioxaspiro[5.5]undecane |
| SMILES | CC[C@H]1CCC[C@@]2(CCC[C@H](C)O2)O1 |
| InChI | InChI=1S/C12H22O2/c1-3-11-7-5-9-12(14-11)8-4-6-10(2)13-12/h10-11H,3-9H2,1-2H3/t10-,11-,12+/m0/s1 |
| InChIKey | ICQGEBLJYVWKBA-SDDRHHMPSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |