C14H24O3 — CID 139254043
(4S,6R,8R,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecane (PubChem CID 139254043) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (4S,6R,8R,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecane.
| Compound Name | (4S,6R,8R,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecane |
|---|---|
| PubChem CID | 139254043 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (4S,6R,8R,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecane |
| SMILES | C[C@H]1CCC[C@@]2(CC[C@@]3(CCC[C@H](C)O3)O2)O1 |
| InChI | InChI=1S/C14H24O3/c1-11-5-3-7-13(15-11)9-10-14(17-13)8-4-6-12(2)16-14/h11-12H,3-10H2,1-2H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | DTHFNKNDKPYZBG-IGQOVBAYSA-N |
| XLogP | 3.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |