C14H22O4 — CID 102119415
(4R,6S,8S,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-one (PubChem CID 102119415) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4R,6S,8S,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-one.
| Compound Name | (4R,6S,8S,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-one |
|---|---|
| PubChem CID | 102119415 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (4R,6S,8S,10S)-4,10-dimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-one |
| SMILES | C[C@@H]1CCC[C@]2(CC[C@]3(O[C@@H](C)CCC3=O)O2)O1 |
| InChI | InChI=1S/C14H22O4/c1-10-4-3-7-13(16-10)8-9-14(18-13)12(15)6-5-11(2)17-14/h10-11H,3-9H2,1-2H3/t10-,11+,13+,14+/m1/s1 |
| InChIKey | ZASFDTGKCHLRQW-XWUBHJNHSA-N |
| XLogP | 2.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |