C11H20O3 — CID 11769525
(2S,4S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undecan-4-ol (PubChem CID 11769525) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2S,4S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undecan-4-ol.
| Compound Name | (2S,4S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undecan-4-ol |
|---|---|
| PubChem CID | 11769525 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (2S,4S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undecan-4-ol |
| SMILES | C[C@H]1CCC[C@@]2(C[C@@H](O)C[C@H](C)O2)O1 |
| InChI | InChI=1S/C11H20O3/c1-8-4-3-5-11(13-8)7-10(12)6-9(2)14-11/h8-10,12H,3-7H2,1-2H3/t8-,9-,10-,11+/m0/s1 |
| InChIKey | UGQSSMAXOUSHAY-XWLWVQCSSA-N |
| XLogP | 1.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |