C13H20O5 — CID 42599431
(1S,2R,5'S,6R,8R)-4,4,5'-trimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,2'-oxolane] (PubChem CID 42599431) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1S,2R,5'S,6R,8R)-4,4,5'-trimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,2'-oxolane].
| Compound Name | (1S,2R,5'S,6R,8R)-4,4,5'-trimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,2'-oxolane] |
|---|---|
| PubChem CID | 42599431 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1S,2R,5'S,6R,8R)-4,4,5'-trimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,2'-oxolane] |
| SMILES | C[C@H]1CCC2(C[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]3O2)O1 |
| InChI | InChI=1S/C13H20O5/c1-7-4-5-13(15-7)6-8-9(17-13)10-11(14-8)18-12(2,3)16-10/h7-11H,4-6H2,1-3H3/t7-,8+,9-,10+,11+,13?/m0/s1 |
| InChIKey | VFHDGORGCBSTRR-CPCCDEMNSA-N |
| XLogP | 1.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |