C11H18O4 — CID 11637098
(3S,5R,7R,10S)-3,10-dimethyl-4,11,12,13-tetraoxadispiro[4.1.47.25]tridecane (PubChem CID 11637098) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3S,5R,7R,10S)-3,10-dimethyl-4,11,12,13-tetraoxadispiro[4.1.47.25]tridecane.
| Compound Name | (3S,5R,7R,10S)-3,10-dimethyl-4,11,12,13-tetraoxadispiro[4.1.47.25]tridecane |
|---|---|
| PubChem CID | 11637098 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (3S,5R,7R,10S)-3,10-dimethyl-4,11,12,13-tetraoxadispiro[4.1.47.25]tridecane |
| SMILES | C[C@H]1CC[C@@]2(C[C@@]3(CC[C@H](C)O3)OO2)O1 |
| InChI | InChI=1S/C11H18O4/c1-8-3-5-10(12-8)7-11(15-14-10)6-4-9(2)13-11/h8-9H,3-7H2,1-2H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | WZWVIYLWIRLKDX-UKKRHICBSA-N |
| XLogP | 2.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|