C8H12O — CID 156644115
2-ethynyl-2,5-dimethyloxolane (PubChem CID 156644115) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is 2-ethynyl-2,5-dimethyloxolane.
| Compound Name | 2-ethynyl-2,5-dimethyloxolane |
|---|---|
| PubChem CID | 156644115 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 2-ethynyl-2,5-dimethyloxolane |
| SMILES | C#CC1(C)CCC(C)O1 |
| InChI | InChI=1S/C8H12O/c1-4-8(3)6-5-7(2)9-8/h1,7H,5-6H2,2-3H3 |
| InChIKey | QVILWQRSPYJOLM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|