C13H20O3 — CID 167274839
[(2R,5S)-2-ethynyl-5-methyloxolan-2-yl]methyl pentanoate (PubChem CID 167274839) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is [(2R,5S)-2-ethynyl-5-methyloxolan-2-yl]methyl pentanoate.
| Compound Name | [(2R,5S)-2-ethynyl-5-methyloxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 167274839 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | [(2R,5S)-2-ethynyl-5-methyloxolan-2-yl]methyl pentanoate |
| SMILES | C#C[C@@]1(COC(=O)CCCC)CC[C@H](C)O1 |
| InChI | InChI=1S/C13H20O3/c1-4-6-7-12(14)15-10-13(5-2)9-8-11(3)16-13/h2,11H,4,6-10H2,1,3H3/t11-,13-/m0/s1 |
| InChIKey | CTMJWNHQTYLYMM-AAEUAGOBSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|