C12H22O4 — CID 130343670
(5-ethyl-1,3-dioxan-5-yl)methyl pentanoate (PubChem CID 130343670) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (5-ethyl-1,3-dioxan-5-yl)methyl pentanoate.
| Compound Name | (5-ethyl-1,3-dioxan-5-yl)methyl pentanoate |
|---|---|
| PubChem CID | 130343670 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (5-ethyl-1,3-dioxan-5-yl)methyl pentanoate |
| SMILES | CCCCC(=O)OCC1(CC)COCOC1 |
| InChI | InChI=1S/C12H22O4/c1-3-5-6-11(13)16-9-12(4-2)7-14-10-15-8-12/h3-10H2,1-2H3 |
| InChIKey | KFYVCGAXUBGFIO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |