About [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate
[5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate (PubChem CID 110174574) has the molecular formula C8H14N2O6
and a molecular weight of 234.21 g/mol. Its IUPAC name is [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate.
Molecular Properties
| Compound Name | [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate |
| PubChem CID | 110174574 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate |
| SMILES | NC(=O)OCC1(COC(N)=O)COCOC1 |
| InChI | InChI=1S/C8H14N2O6/c9-6(11)15-3-8(4-16-7(10)12)1-13-5-14-2-8/h1-5H2,(H2,9,11)(H2,10,12) |
| InChIKey | ADTHDDAXMFCBIE-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate?
The IUPAC name of [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate (CID 110174574) is [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate.
What is the SMILES notation for [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate?
The canonical SMILES for [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate is NC(=O)OCC1(COC(N)=O)COCOC1.
What is the InChIKey of [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate?
The InChIKey is ADTHDDAXMFCBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O6/c9-6(11)15-3-8(4-16-7(10)12)1-13-5-14-2-8/h1-5H2,(H2,9,11)(H2,10,12).
What are the key properties of [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate?
[5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate has a molecular weight of 234.21 g/mol, XLogP of -0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(carbamoyloxymethyl)-1,3-dioxan-5-yl]methyl carbamate is sourced from PubChem (CID 110174574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).