C19H26O6 — CID 91733742
1-O-butyl 4-O-[(5-ethyl-1,3-dioxan-5-yl)methyl] benzene-1,4-dicarboxylate (PubChem CID 91733742) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-O-butyl 4-O-[(5-ethyl-1,3-dioxan-5-yl)methyl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-butyl 4-O-[(5-ethyl-1,3-dioxan-5-yl)methyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91733742 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-O-butyl 4-O-[(5-ethyl-1,3-dioxan-5-yl)methyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)OCC2(CC)COCOC2)cc1 |
| InChI | InChI=1S/C19H26O6/c1-3-5-10-24-17(20)15-6-8-16(9-7-15)18(21)25-13-19(4-2)11-22-14-23-12-19/h6-9H,3-5,10-14H2,1-2H3 |
| InChIKey | BJXAVFHUPQUAHS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|