C11H16F3NO6S — CID 155170717
(3-ethyloxetan-3-yl)methyl 4-oxo-4-(trifluoromethylsulfonylamino)butanoate (PubChem CID 155170717) has the molecular formula C11H16F3NO6S and a molecular weight of 347.31 g/mol. Its IUPAC name is (3-ethyloxetan-3-yl)methyl 4-oxo-4-(trifluoromethylsulfonylamino)butanoate.
| Compound Name | (3-ethyloxetan-3-yl)methyl 4-oxo-4-(trifluoromethylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 155170717 |
| Molecular Formula | C11H16F3NO6S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (3-ethyloxetan-3-yl)methyl 4-oxo-4-(trifluoromethylsulfonylamino)butanoate |
| SMILES | CCC1(COC(=O)CCC(=O)NS(=O)(=O)C(F)(F)F)COC1 |
| InChI | InChI=1S/C11H16F3NO6S/c1-2-10(5-20-6-10)7-21-9(17)4-3-8(16)15-22(18,19)11(12,13)14/h2-7H2,1H3,(H,15,16) |
| InChIKey | SKWUIMRIUGJHIT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |