C10H11F7O2 — CID 118236014
3-ethyl-3-[[(E)-1,1,1,3,4,4,4-heptafluorobut-2-en-2-yl]oxymethyl]oxetane (PubChem CID 118236014) has the molecular formula C10H11F7O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is 3-ethyl-3-[[(E)-1,1,1,3,4,4,4-heptafluorobut-2-en-2-yl]oxymethyl]oxetane.
| Compound Name | 3-ethyl-3-[[(E)-1,1,1,3,4,4,4-heptafluorobut-2-en-2-yl]oxymethyl]oxetane |
|---|---|
| PubChem CID | 118236014 |
| Molecular Formula | C10H11F7O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-ethyl-3-[[(E)-1,1,1,3,4,4,4-heptafluorobut-2-en-2-yl]oxymethyl]oxetane |
| SMILES | CCC1(CO/C(=C(/F)C(F)(F)F)C(F)(F)F)COC1 |
| InChI | InChI=1S/C10H11F7O2/c1-2-8(3-18-4-8)5-19-7(10(15,16)17)6(11)9(12,13)14/h2-5H2,1H3/b7-6+ |
| InChIKey | VWMWSTUEQXFDHV-VOTSOKGWSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|