About (2-amino-2-oxoethyl) pentanoate
(2-amino-2-oxoethyl) pentanoate (PubChem CID 142660312) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) pentanoate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) pentanoate |
| PubChem CID | 142660312 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2-amino-2-oxoethyl) pentanoate |
| SMILES | CCCCC(=O)OCC(N)=O |
| InChI | InChI=1S/C7H13NO3/c1-2-3-4-7(10)11-5-6(8)9/h2-5H2,1H3,(H2,8,9) |
| InChIKey | WRXGWCRYXWBDOO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-2-oxoethyl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) pentanoate?
The IUPAC name of (2-amino-2-oxoethyl) pentanoate (CID 142660312) is (2-amino-2-oxoethyl) pentanoate.
What is the SMILES notation for (2-amino-2-oxoethyl) pentanoate?
The canonical SMILES for (2-amino-2-oxoethyl) pentanoate is CCCCC(=O)OCC(N)=O.
What is the InChIKey of (2-amino-2-oxoethyl) pentanoate?
The InChIKey is WRXGWCRYXWBDOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-2-3-4-7(10)11-5-6(8)9/h2-5H2,1H3,(H2,8,9).
What are the key properties of (2-amino-2-oxoethyl) pentanoate?
(2-amino-2-oxoethyl) pentanoate has a molecular weight of 159.18 g/mol, XLogP of 0.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) pentanoate is sourced from PubChem (CID 142660312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).