About 2-undecanoyloxyacetic acid
2-undecanoyloxyacetic acid (PubChem CID 88767061) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-undecanoyloxyacetic acid.
Molecular Properties
| Compound Name | 2-undecanoyloxyacetic acid |
| PubChem CID | 88767061 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-undecanoyloxyacetic acid |
| SMILES | CCCCCCCCCCC(=O)OCC(=O)O |
| InChI | InChI=1S/C13H24O4/c1-2-3-4-5-6-7-8-9-10-13(16)17-11-12(14)15/h2-11H2,1H3,(H,14,15) |
| InChIKey | LNWVSZXGQLMURR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-undecanoyloxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-undecanoyloxyacetic acid?
The IUPAC name of 2-undecanoyloxyacetic acid (CID 88767061) is 2-undecanoyloxyacetic acid.
What is the SMILES notation for 2-undecanoyloxyacetic acid?
The canonical SMILES for 2-undecanoyloxyacetic acid is CCCCCCCCCCC(=O)OCC(=O)O.
What is the InChIKey of 2-undecanoyloxyacetic acid?
The InChIKey is LNWVSZXGQLMURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-2-3-4-5-6-7-8-9-10-13(16)17-11-12(14)15/h2-11H2,1H3,(H,14,15).
What are the key properties of 2-undecanoyloxyacetic acid?
2-undecanoyloxyacetic acid has a molecular weight of 244.33 g/mol, XLogP of 3.14, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-undecanoyloxyacetic acid is sourced from PubChem (CID 88767061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).